cas: 1079-17-0 — see every product listed under this CAS number, including other names
alpha,alpha',2,3,5,6-Hexachloro-p-xylene, >98.0%(GC) (CAS 1079-17-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | H0065-1G |
| cas | 1079-17-0 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 223.10 Pln | |
| TCI | 5g | 434.54 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1,2,4,5-tetrachloro-3,6-bis(chloromethyl)benzene (CAS 1079-17-0) is a chemical compound with the molecular formula C8H4Cl6 and a molecular weight of 312.8 g/mol. IUPAC name: 1,2,4,5-tetrachloro-3,6-bis(chloromethyl)benzene. InChIKey: IYGDLOMSJZQSGY-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl6 |
|---|---|
| Molecular weight | 312.8 g/mol |
| IUPAC name | 1,2,4,5-tetrachloro-3,6-bis(chloromethyl)benzene |
| InChIKey | IYGDLOMSJZQSGY-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=C(C(=C1Cl)Cl)CCl)Cl)Cl)Cl |
Computed by PubChem (NCBI)