cas: 14230-18-3 — see every product listed under this CAS number, including other names
1,2,4-Benzenetricarboxylic acid, 1,2,4-triethyl ester, 95%, 95% (CAS 14230-18-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11A4LM-1g |
| cas | 14230-18-3 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 549.20 Pln | |
| Chemat | 25g | 1749.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Triethyl benzene-1,2,4-tricarboxylate (CAS 14230-18-3) is a chemical compound with the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. IUPAC name: triethyl benzene-1,2,4-tricarboxylate. InChIKey: NGXQRWJDOKUJEN-UHFFFAOYSA-N.
| Molecular formula | C15H18O6 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | triethyl benzene-1,2,4-tricarboxylate |
| InChIKey | NGXQRWJDOKUJEN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)C(=O)OCC)C(=O)OCC |
Computed by PubChem (NCBI)