1,2-Bis(4-(pyridin-4-yl)phenyl)ethane-1,2-dione, 95%
cas: 1352050-00-0 — see every product listed under this CAS number, including other names
1,2-Bis(4-(pyridin-4-yl)phenyl)ethane-1,2-dione, 95% (CAS 1352050-00-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1494280-100mg |
| cas | 1352050-00-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 459.38 Pln | |
| Ambeed | 250mg | 743.06 Pln | |
| Ambeed | 1g | 1755.44 Pln | |
| Chemat | 100mg | 419.60 Pln | |
| Chemat | 250mg | 669.20 Pln | |
| Chemat | 1g | 1696.40 Pln | |
| BLDpharm | 100mg | 453.20 Pln | |
| BLDpharm | 250mg | 725.32 Pln | |
| BLDpharm | 1g | 1730.53 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1,2-bis(4-pyridin-4-ylphenyl)ethane-1,2-dione (CAS 1352050-00-0) is a chemical compound with the molecular formula C24H16N2O2 and a molecular weight of 364.4 g/mol. IUPAC name: 1,2-bis(4-pyridin-4-ylphenyl)ethane-1,2-dione. InChIKey: WMGXFGWLIHZWNA-UHFFFAOYSA-N.
| Molecular formula | C24H16N2O2 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 1,2-bis(4-pyridin-4-ylphenyl)ethane-1,2-dione |
| InChIKey | WMGXFGWLIHZWNA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=NC=C2)C(=O)C(=O)C3=CC=C(C=C3)C4=CC=NC=C4 |
Computed by PubChem (NCBI)