CAS 88498-43-5 is the registry number for 4,4'-(1,10-Phenanthroline-2,9-diyl)diphenol, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[9-(4-hydroxyphenyl)-1,10-phenanthrolin-2-yl]phenol (CAS 88498-43-5) is a chemical compound with the molecular formula C24H16N2O2 and a molecular weight of 364.4 g/mol. IUPAC name: 4-[9-(4-hydroxyphenyl)-1,10-phenanthrolin-2-yl]phenol. InChIKey: GTOXEYAZDAJKFU-UHFFFAOYSA-N.
| Molecular formula | C24H16N2O2 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 4-[9-(4-hydroxyphenyl)-1,10-phenanthrolin-2-yl]phenol |
| InChIKey | GTOXEYAZDAJKFU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C1C=CC(=N3)C4=CC=C(C=C4)O)N=C(C=C2)C5=CC=C(C=C5)O |
Computed by PubChem (NCBI)