CAS 1352050-00-0 appears in our catalog under these names: 1,2-Bis(4-(pyridin-4-yl)phenyl)ethane-1,2-dione, 95%, 95%, 1,2-Bis(4-(4-pyridyl)-phenyl)ethane-1,2-dione, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1,2-bis(4-pyridin-4-ylphenyl)ethane-1,2-dione (CAS 1352050-00-0) is a chemical compound with the molecular formula C24H16N2O2 and a molecular weight of 364.4 g/mol. IUPAC name: 1,2-bis(4-pyridin-4-ylphenyl)ethane-1,2-dione. InChIKey: WMGXFGWLIHZWNA-UHFFFAOYSA-N.
| Molecular formula | C24H16N2O2 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 1,2-bis(4-pyridin-4-ylphenyl)ethane-1,2-dione |
| InChIKey | WMGXFGWLIHZWNA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=NC=C2)C(=O)C(=O)C3=CC=C(C=C3)C4=CC=NC=C4 |
Computed by PubChem (NCBI)