CAS 24171-38-8 is the registry number for 1,4-Bis(2-phenyloxazol-4-yl)benzene, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-phenyl-4-[4-(2-phenyl-1,3-oxazol-4-yl)phenyl]-1,3-oxazole (CAS 24171-38-8) is a chemical compound with the molecular formula C24H16N2O2 and a molecular weight of 364.4 g/mol. IUPAC name: 2-phenyl-4-[4-(2-phenyl-1,3-oxazol-4-yl)phenyl]-1,3-oxazole. InChIKey: WVGGQEKOYSUUOQ-UHFFFAOYSA-N.
| Molecular formula | C24H16N2O2 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 2-phenyl-4-[4-(2-phenyl-1,3-oxazol-4-yl)phenyl]-1,3-oxazole |
| InChIKey | WVGGQEKOYSUUOQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CO2)C3=CC=C(C=C3)C4=COC(=N4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)