Products 62638-50-0
CAS 62638-50-0 is the registry number for 8-Hydroxy-6,9-diphenyl-10H-pyrido(1,2-a)quinoxalin-10-one. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 1000mg, 500mg.
8-hydroxy-6,9-diphenylpyrido[1,2-a]quinoxalin-10-one (CAS 62638-50-0) is a chemical compound with the molecular formula C24H16N2O2 and a molecular weight of 364.4 g/mol. IUPAC name: 8-hydroxy-6,9-diphenylpyrido[1,2-a]quinoxalin-10-one. InChIKey: QTVDXJJXCPCAKD-UHFFFAOYSA-N.
| Molecular formula | C24H16N2O2 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 8-hydroxy-6,9-diphenylpyrido[1,2-a]quinoxalin-10-one |
| InChIKey | QTVDXJJXCPCAKD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C3C(=NC4=CC=CC=C4N3C2=O)C5=CC=CC=C5)O |
Computed by PubChem (NCBI)