cas: 2132-59-4 — see every product listed under this CAS number, including other names
1,2-Bis(4-ethoxyphenyl)-1,2-ethanedione, 95%, 95% (CAS 2132-59-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BQB7-100mg |
| cas | 2132-59-4 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1442.00 Pln | |
| Chemat | 250mg | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,2-bis(4-ethoxyphenyl)ethane-1,2-dione (CAS 2132-59-4) is a chemical compound with the molecular formula C18H18O4 and a molecular weight of 298.3 g/mol. IUPAC name: 1,2-bis(4-ethoxyphenyl)ethane-1,2-dione. InChIKey: MINRQLDDFIBLCI-UHFFFAOYSA-N.
| Molecular formula | C18H18O4 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | 1,2-bis(4-ethoxyphenyl)ethane-1,2-dione |
| InChIKey | MINRQLDDFIBLCI-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C(=O)C(=O)C2=CC=C(C=C2)OCC |
Computed by PubChem (NCBI)