cas: 50594-31-5 — see every product listed under this CAS number, including other names
1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene, 97% (CAS 50594-31-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F318236-1G |
| cas | 50594-31-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 154.13 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1,2-dichloro-4-nitro-5-(trifluoromethyl)benzene (CAS 50594-31-5) is a chemical compound with the molecular formula C7H2Cl2F3NO2 and a molecular weight of 259.99 g/mol. IUPAC name: 1,2-dichloro-4-nitro-5-(trifluoromethyl)benzene. InChIKey: MMUARSWOJRDXBV-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F3NO2 |
|---|---|
| Molecular weight | 259.99 g/mol |
| IUPAC name | 1,2-dichloro-4-nitro-5-(trifluoromethyl)benzene |
| InChIKey | MMUARSWOJRDXBV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)