CAS 50594-31-5 appears in our catalog under these names: 4,5-Dichloro-2-nitrobenzotrifluoride, 98%, 1,2-Dichloro-4-nitro-5-(trifluoromethyl)benzene, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g.
1,2-dichloro-4-nitro-5-(trifluoromethyl)benzene (CAS 50594-31-5) is a chemical compound with the molecular formula C7H2Cl2F3NO2 and a molecular weight of 259.99 g/mol. IUPAC name: 1,2-dichloro-4-nitro-5-(trifluoromethyl)benzene. InChIKey: MMUARSWOJRDXBV-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F3NO2 |
|---|---|
| Molecular weight | 259.99 g/mol |
| IUPAC name | 1,2-dichloro-4-nitro-5-(trifluoromethyl)benzene |
| InChIKey | MMUARSWOJRDXBV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)