Products 1803801-74-2
CAS 1803801-74-2 appears in our catalog under these names: 2,3-Dichloro-1-nitro-4-(trifluoromethyl)benzene, 95%, 2，3–Dichloro–1–nitro–4–(trifluoromethyl)benzene. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg, 100mg.
2,3-dichloro-1-nitro-4-(trifluoromethyl)benzene (CAS 1803801-74-2) is a chemical compound with the molecular formula C7H2Cl2F3NO2 and a molecular weight of 259.99 g/mol. IUPAC name: 2,3-dichloro-1-nitro-4-(trifluoromethyl)benzene. InChIKey: UFVXYWZWRSOUSG-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F3NO2 |
|---|---|
| Molecular weight | 259.99 g/mol |
| IUPAC name | 2,3-dichloro-1-nitro-4-(trifluoromethyl)benzene |
| InChIKey | UFVXYWZWRSOUSG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)