Products 2761296-99-3

CAS 2761296-99-3 is the registry number for 3,6-Dichloro-5-(trifluoromethyl)picolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3,6-dichloro-5-(trifluoromethyl)pyridine-2-carboxylic acid (CAS 2761296-99-3) is a chemical compound with the molecular formula C7H2Cl2F3NO2 and a molecular weight of 259.99 g/mol. IUPAC name: 3,6-dichloro-5-(trifluoromethyl)pyridine-2-carboxylic acid. InChIKey: YSIOGOHXCAUBNG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H2Cl2F3NO2
Molecular weight259.99 g/mol
IUPAC name3,6-dichloro-5-(trifluoromethyl)pyridine-2-carboxylic acid
InChIKeyYSIOGOHXCAUBNG-UHFFFAOYSA-N
SMILESC1=C(C(=NC(=C1Cl)C(=O)O)Cl)C(F)(F)F

Computed by PubChem (NCBI)