CAS 203915-49-5 appears in our catalog under these names: 2,4-Dichloro-3-nitrobenzotrifluoride, 95%, 2,4-Dichloro-3-Nitrobenzotrifluoride. Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 1g, 250mg.
1,3-dichloro-2-nitro-4-(trifluoromethyl)benzene (CAS 203915-49-5) is a chemical compound with the molecular formula C7H2Cl2F3NO2 and a molecular weight of 259.99 g/mol. IUPAC name: 1,3-dichloro-2-nitro-4-(trifluoromethyl)benzene. InChIKey: DIMKVPKLQUPPFN-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F3NO2 |
|---|---|
| Molecular weight | 259.99 g/mol |
| IUPAC name | 1,3-dichloro-2-nitro-4-(trifluoromethyl)benzene |
| InChIKey | DIMKVPKLQUPPFN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)