1,2-Diphenyl-1-ethanone oxime, 98%, 98%
cas: 952-06-7 — see every product listed under this CAS number, including other names
1,2-Diphenyl-1-ethanone oxime, 98%, 98% (CAS 952-06-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 2g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147NL-250mg |
| cas | 952-06-7 |
| size | 250mg |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 500mg | 165.20 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 2g | 299.60 Pln | |
| Chemat | 5g | 506.00 Pln | |
| Chemat | 10g | 750.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(NZ)-N-(1,2-diphenylethylidene)hydroxylamine (CAS 952-06-7) is a chemical compound with the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. IUPAC name: (NZ)-N-(1,2-diphenylethylidene)hydroxylamine. InChIKey: PWCUVRROUAKTLL-PFONDFGASA-N.
| Molecular formula | C14H13NO |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | (NZ)-N-(1,2-diphenylethylidene)hydroxylamine |
| InChIKey | PWCUVRROUAKTLL-PFONDFGASA-N |
| SMILES | C1=CC=C(C=C1)C/C(=N/O)/C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
Acetophenone, 2-phenyl-, oxime, Ethanone, 1,2-diphenyl-, oxime, PWCUVRROUAKTLL-PFONDFGASA-N, 1,2-diphenyl-1-ethanone oxime, (Z)-1,2-Diphenylethanone oxime, (1Z)-1,2-Diphenyl-ethanone Oxime, 1,2-Diphenylethanone oxime, Parecoxib Sodium Impurity 28, Parecoxib Sodium Impurity 61, Ethanone,2-diphenyl-, oxime