cas: 451-40-1 — see every product listed under this CAS number, including other names
1,2-Diphenylethanone, 98%, 98% (CAS 451-40-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118188-5g |
| cas | 451-40-1 |
| size | 5g |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 50g | 93.20 Pln | |
| Chemat | 100g | 117.20 Pln | |
| Chemat | 250g | 194.00 Pln | |
| Chemat | 500g | 379.20 Pln | |
| Chemat | 1kg | 664.40 Pln | |
| Chemat | 5kg | 3417.60 Pln | |
| Chemat | 10kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,2-diphenylethanone (CAS 451-40-1) is a chemical compound with the molecular formula C14H12O and a molecular weight of 196.24 g/mol. IUPAC name: 1,2-diphenylethanone. InChIKey: OTKCEEWUXHVZQI-UHFFFAOYSA-N.
| Molecular formula | C14H12O |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 1,2-diphenylethanone |
| InChIKey | OTKCEEWUXHVZQI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)