CAS 451-40-1 appears in our catalog under these names: Parecoxib Impurity 53, 2-Phenylacetophenone, >95% (HPLC), 2–Phenylacetophenone, Deoxybenzoin, Deoxybenzoin, 97% . Offered by: Chemat Brand, TRC, GLPBio, TargetMol, Thermo Scientific (Alfa Aesar). Available pack sizes: on request, 50g, 5g, 500g, 10mg, 25mg, 50mg, 100mg.
1,2-diphenylethanone (CAS 451-40-1) is a chemical compound with the molecular formula C14H12O and a molecular weight of 196.24 g/mol. IUPAC name: 1,2-diphenylethanone. InChIKey: OTKCEEWUXHVZQI-UHFFFAOYSA-N.
| Molecular formula | C14H12O |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 1,2-diphenylethanone |
| InChIKey | OTKCEEWUXHVZQI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)