cas: 2002-03-1 — see every product listed under this CAS number, including other names
1,3,4-Thiadiazol-2-amine, 5-phenyl-, 96%, 96% (CAS 2002-03-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100g, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113CM0-250mg |
| cas | 2002-03-1 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 100g | 2046.80 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 251.60 Pln | |
| Chemat | 10g | 357.20 Pln | |
| Chemat | 25g | 650.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
5-phenyl-1,3,4-thiadiazol-2-amine (CAS 2002-03-1) is a chemical compound with the molecular formula C8H7N3S and a molecular weight of 177.23 g/mol. IUPAC name: 5-phenyl-1,3,4-thiadiazol-2-amine. InChIKey: UHZHEOAEJRHUBW-UHFFFAOYSA-N.
| Molecular formula | C8H7N3S |
|---|---|
| Molecular weight | 177.23 g/mol |
| IUPAC name | 5-phenyl-1,3,4-thiadiazol-2-amine |
| InChIKey | UHZHEOAEJRHUBW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(S2)N |
Computed by PubChem (NCBI)