cas: 2002-03-1 — see every product listed under this CAS number, including other names
5-Phenyl-1,3,4-thiadiazole-2-yl-amine, 96% (CAS 2002-03-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F012187-1G |
| cas | 2002-03-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 315.53 Pln | |
| Fluorochem | 10g | 440.49 Pln | |
| Fluorochem | 25g | 846.59 Pln | |
| Fluorochem | 100g | 2580.36 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
5-phenyl-1,3,4-thiadiazol-2-amine (CAS 2002-03-1) is a chemical compound with the molecular formula C8H7N3S and a molecular weight of 177.23 g/mol. IUPAC name: 5-phenyl-1,3,4-thiadiazol-2-amine. InChIKey: UHZHEOAEJRHUBW-UHFFFAOYSA-N.
| Molecular formula | C8H7N3S |
|---|---|
| Molecular weight | 177.23 g/mol |
| IUPAC name | 5-phenyl-1,3,4-thiadiazol-2-amine |
| InChIKey | UHZHEOAEJRHUBW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(S2)N |
Computed by PubChem (NCBI)