cas: 827-16-7 — see every product listed under this CAS number, including other names
1,3,5-Trimethyl-1,3,5-triazine-2,4,6(1H,3H,5H)-trione, 95%, 95% (CAS 827-16-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114ATP-100mg |
| cas | 827-16-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 371.60 Pln | |
| Chemat | 250mg | 678.80 Pln | |
| Chemat | 1g | 1869.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,3,5-trimethyl-1,3,5-triazinane-2,4,6-trione (CAS 827-16-7) is a chemical compound with the molecular formula C6H9N3O3 and a molecular weight of 171.15 g/mol. IUPAC name: 1,3,5-trimethyl-1,3,5-triazinane-2,4,6-trione. InChIKey: AHWDQDMGFXRVFB-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O3 |
|---|---|
| Molecular weight | 171.15 g/mol |
| IUPAC name | 1,3,5-trimethyl-1,3,5-triazinane-2,4,6-trione |
| InChIKey | AHWDQDMGFXRVFB-UHFFFAOYSA-N |
| SMILES | CN1C(=O)N(C(=O)N(C1=O)C)C |
Computed by PubChem (NCBI)