cas: 827-16-7 — see every product listed under this CAS number, including other names
Trimethyl-1,3,5-triazinane-2,4,6-trione 95% (CAS 827-16-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1085197-100mg |
| cas | 827-16-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 531.69 Pln | |
| Ambeed | 250mg | 987.81 Pln | |
| Ambeed | 1g | 2361.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1085197 |
1,3,5-trimethyl-1,3,5-triazinane-2,4,6-trione (CAS 827-16-7) is a chemical compound with the molecular formula C6H9N3O3 and a molecular weight of 171.15 g/mol. IUPAC name: 1,3,5-trimethyl-1,3,5-triazinane-2,4,6-trione. InChIKey: AHWDQDMGFXRVFB-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O3 |
|---|---|
| Molecular weight | 171.15 g/mol |
| IUPAC name | 1,3,5-trimethyl-1,3,5-triazinane-2,4,6-trione |
| InChIKey | AHWDQDMGFXRVFB-UHFFFAOYSA-N |
| SMILES | CN1C(=O)N(C(=O)N(C1=O)C)C |
Computed by PubChem (NCBI)