cas: 6972-79-8 — see every product listed under this CAS number, including other names
1,3-Bis(benzyloxy)-2-propanol, >96.0%(GC) (CAS 6972-79-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B2110-5G |
| cas | 6972-79-8 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 280.61 Pln | |
| TCI | 25g | 851.02 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >96.0%(GC) |
1,3-bis(phenylmethoxy)propan-2-ol (CAS 6972-79-8) is a chemical compound with the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. IUPAC name: 1,3-bis(phenylmethoxy)propan-2-ol. InChIKey: ARLSYSVVBAMYKA-UHFFFAOYSA-N.
| Molecular formula | C17H20O3 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | 1,3-bis(phenylmethoxy)propan-2-ol |
| InChIKey | ARLSYSVVBAMYKA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCC(COCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)