CAS 68641-85-0 appears in our catalog under these names: Isopropyl 2-(6-methoxynaphthalen-2-yl)propanoate, 95+%, rac-Naproxen 2-Propyl Ester, rac-Naproxen 2-Propyl Ester, >95% (HPLC), RAC-NAPROXEN ISOPROPYL ESTER. Offered by: Chemat Brand, TRC, Sigma-Aldrich. Available pack sizes: on request, 2,5g, 250mg, 25MG.
Propan-2-yl 2-(6-methoxynaphthalen-2-yl)propanoate (CAS 68641-85-0) is a chemical compound with the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. IUPAC name: propan-2-yl 2-(6-methoxynaphthalen-2-yl)propanoate. InChIKey: KABDXMXJNHRMMO-UHFFFAOYSA-N.
| Molecular formula | C17H20O3 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | propan-2-yl 2-(6-methoxynaphthalen-2-yl)propanoate |
| InChIKey | KABDXMXJNHRMMO-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C(C)C1=CC2=C(C=C1)C=C(C=C2)OC |
Computed by PubChem (NCBI)