Products 2194580-67-9
CAS 2194580-67-9 appears in our catalog under these names: Peniphenylane D, 4-((2-hydroxy-6-methylphenyl)methyl)-2-(methoxymethyl)-3-methyl-phenol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
4-[(2-hydroxy-6-methylphenyl)methyl]-2-(methoxymethyl)-3-methylphenol (CAS 2194580-67-9) is a chemical compound with the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. IUPAC name: 4-[(2-hydroxy-6-methylphenyl)methyl]-2-(methoxymethyl)-3-methylphenol. InChIKey: VXXHCMVDPUIJCR-UHFFFAOYSA-N.
| Molecular formula | C17H20O3 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | 4-[(2-hydroxy-6-methylphenyl)methyl]-2-(methoxymethyl)-3-methylphenol |
| InChIKey | VXXHCMVDPUIJCR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)O)CC2=C(C(=C(C=C2)O)COC)C |
Computed by PubChem (NCBI)