Products 362523-40-8
CAS 362523-40-8 is the registry number for tert-Butyl (6-methoxynaphthalen-2-yl)acetate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
Tert-butyl 2-(6-methoxynaphthalen-2-yl)acetate (CAS 362523-40-8) is a chemical compound with the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. IUPAC name: tert-butyl 2-(6-methoxynaphthalen-2-yl)acetate. InChIKey: RMKLMSNNWZHKPK-UHFFFAOYSA-N.
| Molecular formula | C17H20O3 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | tert-butyl 2-(6-methoxynaphthalen-2-yl)acetate |
| InChIKey | RMKLMSNNWZHKPK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC1=CC2=C(C=C1)C=C(C=C2)OC |
Computed by PubChem (NCBI)