Products 59991-89-8

CAS 59991-89-8 is the registry number for 2,3-Bis(benzyloxy)propan-1-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2,3-bis(phenylmethoxy)propan-1-ol (CAS 59991-89-8) is a chemical compound with the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. IUPAC name: 2,3-bis(phenylmethoxy)propan-1-ol. InChIKey: FBDGHDWQYGJZQU-UHFFFAOYSA-N.

Identity
Molecular formulaC17H20O3
Molecular weight272.34 g/mol
IUPAC name2,3-bis(phenylmethoxy)propan-1-ol
InChIKeyFBDGHDWQYGJZQU-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COCC(CO)OCC2=CC=CC=C2

Computed by PubChem (NCBI)