cas: 153338-23-9 — see every product listed under this CAS number, including other names
1,3-Difluoro-2-(trifluoromethoxy)benzene, 97% (CAS 153338-23-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F244775-250MG |
| cas | 153338-23-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 341.56 Pln | |
| Fluorochem | 25g | 1403.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1,3-difluoro-2-(trifluoromethoxy)benzene (CAS 153338-23-9) is a chemical compound with the molecular formula C7H3F5O and a molecular weight of 198.09 g/mol. IUPAC name: 1,3-difluoro-2-(trifluoromethoxy)benzene. InChIKey: CETQITNIBDFSTM-UHFFFAOYSA-N.
| Molecular formula | C7H3F5O |
|---|---|
| Molecular weight | 198.09 g/mol |
| IUPAC name | 1,3-difluoro-2-(trifluoromethoxy)benzene |
| InChIKey | CETQITNIBDFSTM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)OC(F)(F)F)F |
Computed by PubChem (NCBI)