Products 1404194-50-8
CAS 1404194-50-8 appears in our catalog under these names: 1,3-Difluoro-5-(trifluoromethoxy)benzene, 95%, 1,3-Difluoro-5-(trifluoromethoxy)benzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
1,3-difluoro-5-(trifluoromethoxy)benzene (CAS 1404194-50-8) is a chemical compound with the molecular formula C7H3F5O and a molecular weight of 198.09 g/mol. IUPAC name: 1,3-difluoro-5-(trifluoromethoxy)benzene. InChIKey: LDNQHCRDKTWUGG-UHFFFAOYSA-N.
| Molecular formula | C7H3F5O |
|---|---|
| Molecular weight | 198.09 g/mol |
| IUPAC name | 1,3-difluoro-5-(trifluoromethoxy)benzene |
| InChIKey | LDNQHCRDKTWUGG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)OC(F)(F)F |
Computed by PubChem (NCBI)