Products 276244-25-8
CAS 276244-25-8 is the registry number for 2,6-Difluoro-4-(trifluoromethyl)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,6-difluoro-4-(trifluoromethyl)phenol (CAS 276244-25-8) is a chemical compound with the molecular formula C7H3F5O and a molecular weight of 198.09 g/mol. IUPAC name: 2,6-difluoro-4-(trifluoromethyl)phenol. InChIKey: DYSIHTLTKLQXFN-UHFFFAOYSA-N.
| Molecular formula | C7H3F5O |
|---|---|
| Molecular weight | 198.09 g/mol |
| IUPAC name | 2,6-difluoro-4-(trifluoromethyl)phenol |
| InChIKey | DYSIHTLTKLQXFN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)O)F)C(F)(F)F |
Computed by PubChem (NCBI)