Products 1378671-81-8
CAS 1378671-81-8 is the registry number for 1,2-Difluoro-4-(trifluoromethoxy)benzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 25g.
1,2-difluoro-4-(trifluoromethoxy)benzene (CAS 1378671-81-8) is a chemical compound with the molecular formula C7H3F5O and a molecular weight of 198.09 g/mol. IUPAC name: 1,2-difluoro-4-(trifluoromethoxy)benzene. InChIKey: FWWOBFYWVKAXNS-UHFFFAOYSA-N.
| Molecular formula | C7H3F5O |
|---|---|
| Molecular weight | 198.09 g/mol |
| IUPAC name | 1,2-difluoro-4-(trifluoromethoxy)benzene |
| InChIKey | FWWOBFYWVKAXNS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)F)F |
Computed by PubChem (NCBI)