Products 116640-12-1
CAS 116640-12-1 appears in our catalog under these names: 2,3-Difluoro-4-(trifluoromethyl)phenol, 95%, 2,3-Difluoro-4-(trifluoromethyl)phenol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg, 500mg, 1000mg.
2,3-difluoro-4-(trifluoromethyl)phenol (CAS 116640-12-1) is a chemical compound with the molecular formula C7H3F5O and a molecular weight of 198.09 g/mol. IUPAC name: 2,3-difluoro-4-(trifluoromethyl)phenol. InChIKey: WWJVQVQWMHTPNE-UHFFFAOYSA-N.
| Molecular formula | C7H3F5O |
|---|---|
| Molecular weight | 198.09 g/mol |
| IUPAC name | 2,3-difluoro-4-(trifluoromethyl)phenol |
| InChIKey | WWJVQVQWMHTPNE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)F)F)O |
Computed by PubChem (NCBI)