cas: 66684-62-6 — see every product listed under this CAS number, including other names
1,3-Difluoro-5-methoxy-2-nitrobenzene 98% (CAS 66684-62-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A456394-100mg |
| cas | 66684-62-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 542.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A456394 |
1,3-difluoro-5-methoxy-2-nitrobenzene (CAS 66684-62-6) is a chemical compound with the molecular formula C7H5F2NO3 and a molecular weight of 189.12 g/mol. IUPAC name: 1,3-difluoro-5-methoxy-2-nitrobenzene. InChIKey: YNHSGDUOWUPKKQ-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO3 |
|---|---|
| Molecular weight | 189.12 g/mol |
| IUPAC name | 1,3-difluoro-5-methoxy-2-nitrobenzene |
| InChIKey | YNHSGDUOWUPKKQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)