Products 1211581-51-9
CAS 1211581-51-9 appears in our catalog under these names: 2-(Difluoromethoxy)isonicotinic acid, 95%, 2–(Difluoromethoxy)isonicotinic acid, 2-(Difluoromethoxy)isonicotinic acid, 2-(Difluoromethoxy)isonicotinic acid 95%, 2-(Difluoromethoxy)isonicotinic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 25g, 10g, 1g, 100mg.
2-(difluoromethoxy)pyridine-4-carboxylic acid (CAS 1211581-51-9) is a chemical compound with the molecular formula C7H5F2NO3 and a molecular weight of 189.12 g/mol. IUPAC name: 2-(difluoromethoxy)pyridine-4-carboxylic acid. InChIKey: UZXZLODCGSAFNJ-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO3 |
|---|---|
| Molecular weight | 189.12 g/mol |
| IUPAC name | 2-(difluoromethoxy)pyridine-4-carboxylic acid |
| InChIKey | UZXZLODCGSAFNJ-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C(=O)O)OC(F)F |
Computed by PubChem (NCBI)