CAS 914095-13-9 appears in our catalog under these names: (4,5-Difluoro-2-nitrophenyl)methanol, 95%, (4,5-Difluoro-2-nitrophenyl)methanol, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 250mg.
(4,5-difluoro-2-nitrophenyl)methanol (CAS 914095-13-9) is a chemical compound with the molecular formula C7H5F2NO3 and a molecular weight of 189.12 g/mol. IUPAC name: (4,5-difluoro-2-nitrophenyl)methanol. InChIKey: BPPXTUUKWURHBO-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO3 |
|---|---|
| Molecular weight | 189.12 g/mol |
| IUPAC name | (4,5-difluoro-2-nitrophenyl)methanol |
| InChIKey | BPPXTUUKWURHBO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)[N+](=O)[O-])CO |
Computed by PubChem (NCBI)