CAS 66684-62-6 appears in our catalog under these names: 1,3-Difluoro-5-methoxy-2-nitrobenzene, 98%, 1,3–Difluoro–5–methoxy–2–nitrobenzene, 1,3-Difluoro-5-methoxy-2-nitrobenzene 98%, 1,3-Difluoro-5-methoxy-2-nitrobenzene, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 100mg, 250mg.
1,3-difluoro-5-methoxy-2-nitrobenzene (CAS 66684-62-6) is a chemical compound with the molecular formula C7H5F2NO3 and a molecular weight of 189.12 g/mol. IUPAC name: 1,3-difluoro-5-methoxy-2-nitrobenzene. InChIKey: YNHSGDUOWUPKKQ-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO3 |
|---|---|
| Molecular weight | 189.12 g/mol |
| IUPAC name | 1,3-difluoro-5-methoxy-2-nitrobenzene |
| InChIKey | YNHSGDUOWUPKKQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)