CAS 1174323-34-2 appears in our catalog under these names: 2-Pyridinecarboxylic acid, 5-(difluoromethoxy)-, 98%, 98%, 5-(Difluoromethoxy)picolinic acid, 95%, 5–(Difluoromethoxy)picolinic acid, 5-(Difluoromethoxy)picolinic acid, 5-(Difluoromethoxy)picolinic acid 98%. Offered by: Chemat, Combi-blocks, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 2,5g.
5-(difluoromethoxy)pyridine-2-carboxylic acid (CAS 1174323-34-2) is a chemical compound with the molecular formula C7H5F2NO3 and a molecular weight of 189.12 g/mol. IUPAC name: 5-(difluoromethoxy)pyridine-2-carboxylic acid. InChIKey: QOGGIPBAUKZCGU-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO3 |
|---|---|
| Molecular weight | 189.12 g/mol |
| IUPAC name | 5-(difluoromethoxy)pyridine-2-carboxylic acid |
| InChIKey | QOGGIPBAUKZCGU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1OC(F)F)C(=O)O |
Computed by PubChem (NCBI)