cas: 60526-81-0 — see every product listed under this CAS number, including other names
1,3-Dimethoxy-5-(2-methyloctan-2-yl)benzene, ≥97%, ≥97% (CAS 60526-81-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DK8-100mg |
| cas | 60526-81-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 438.80 Pln | |
| Chemat | 250mg | 539.60 Pln | |
| Chemat | 1g | 683.60 Pln | |
| Chemat | 5g | 1749.20 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
1,3-dimethoxy-5-(2-methyloctan-2-yl)benzene (CAS 60526-81-0) is a chemical compound with the molecular formula C17H28O2 and a molecular weight of 264.4 g/mol. IUPAC name: 1,3-dimethoxy-5-(2-methyloctan-2-yl)benzene. InChIKey: MYYOUJBZUGHFNX-UHFFFAOYSA-N.
| Molecular formula | C17H28O2 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | 1,3-dimethoxy-5-(2-methyloctan-2-yl)benzene |
| InChIKey | MYYOUJBZUGHFNX-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C)(C)C1=CC(=CC(=C1)OC)OC |
Computed by PubChem (NCBI)