CAS 1346600-52-9 appears in our catalog under these names: 4-Nonyl Phenol-13C6 Monoethoxylate, >95% (GC), 4-Nonyl phenol monoethoxylate-13C6. Offered by: TRC, MedChemExpress. Available pack sizes: 0,5mg, 5mg, Get quote.
2-(4-nonyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxyethanol (CAS 1346600-52-9) is a chemical compound with the molecular formula C17H28O2 and a molecular weight of 270.36 g/mol. IUPAC name: 2-(4-nonyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxyethanol. InChIKey: KUXGUCNZFCVULO-BBONSKRCSA-N.
| Molecular formula | C17H28O2 |
|---|---|
| Molecular weight | 270.36 g/mol |
| IUPAC name | 2-(4-nonyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxyethanol |
| InChIKey | KUXGUCNZFCVULO-BBONSKRCSA-N |
| SMILES | CCCCCCCCC[13C]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)OCCO |
Computed by PubChem (NCBI)