CAS 3080-84-0 appears in our catalog under these names: 2,6-Di-tert-butyl-4-ethoxymethyl-phenol, 95%, 2,6-Bis(1,1-Dimethylethyl)-4-(Ethoxymethyl)Phenol, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 100mg, 250mg.
2,6-ditert-butyl-4-(ethoxymethyl)phenol (CAS 3080-84-0) is a chemical compound with the molecular formula C17H28O2 and a molecular weight of 264.4 g/mol. IUPAC name: 2,6-ditert-butyl-4-(ethoxymethyl)phenol. InChIKey: UCKUPWJWVMQSKH-UHFFFAOYSA-N.
| Molecular formula | C17H28O2 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-(ethoxymethyl)phenol |
| InChIKey | UCKUPWJWVMQSKH-UHFFFAOYSA-N |
| SMILES | CCOCC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C |
Computed by PubChem (NCBI)