Products 36294-23-2

CAS 36294-23-2 is the registry number for 2,6-Di-tert-butyl-4-(3-hydroxypropyl)phenol. Offered by: Biosynth, Chemat. Available pack sizes: 25g, 10g, 50g, 10mg, 25mg, 100mg.

Structural formula: {0} (CAS {1})

2,6-ditert-butyl-4-(3-hydroxypropyl)phenol (CAS 36294-23-2) is a chemical compound with the molecular formula C17H28O2 and a molecular weight of 264.4 g/mol. IUPAC name: 2,6-ditert-butyl-4-(3-hydroxypropyl)phenol. InChIKey: KPYNPYLYIYBHEI-UHFFFAOYSA-N.

Identity
Molecular formulaC17H28O2
Molecular weight264.4 g/mol
IUPAC name2,6-ditert-butyl-4-(3-hydroxypropyl)phenol
InChIKeyKPYNPYLYIYBHEI-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)CCCO

Computed by PubChem (NCBI)