CAS 2733264-27-0 appears in our catalog under these names: 4-n-Nonylphenol-mono-ethoxylate D4 100 µg/mL in Acetone, 4-Nonyl phenol monoethoxylate-d4. Offered by: Dr. Ehrenstorfer, MedChemExpress. Available pack sizes: 1ml, Get quote.
1,1,2,2-tetradeuterio-2-(4-nonylphenoxy)ethanol (CAS 2733264-27-0) is a chemical compound with the molecular formula C17H28O2 and a molecular weight of 268.4 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-(4-nonylphenoxy)ethanol. InChIKey: KUXGUCNZFCVULO-QZPARXMSSA-N.
| Molecular formula | C17H28O2 |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-(4-nonylphenoxy)ethanol |
| InChIKey | KUXGUCNZFCVULO-QZPARXMSSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])OC1=CC=C(C=C1)CCCCCCCCC)O |
Computed by PubChem (NCBI)