cas: 25252-46-4 — see every product listed under this CAS number, including other names
1,3-Dimethyl-1H-thieno[2,3-c]pyrazole-5-carboxylic acid 98% (CAS 25252-46-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A389355-1g |
| cas | 25252-46-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 542.81 Pln | |
| Ambeed | 25g | 2295.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A389355 |
1,3-dimethylthieno[3,2-d]pyrazole-5-carboxylic acid (CAS 25252-46-4) is a chemical compound with the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. IUPAC name: 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxylic acid. InChIKey: QRANSYHQSVJLHX-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxylic acid |
| InChIKey | QRANSYHQSVJLHX-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=C(S2)C(=O)O)C |
Computed by PubChem (NCBI)