cas: 3920-37-4 — see every product listed under this CAS number, including other names
1,3-Dimethyl-4-nitro-1H-pyrazole-5-carboxylic acid 95% (CAS 3920-37-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A290773-100mg |
| cas | 3920-37-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 1321.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A290773 |
1,3-dimethyl-4-nitropyrazole-5-carboxylic acid (CAS 3920-37-4) is a chemical compound with the molecular formula C6H7N3O4 and a molecular weight of 185.14 g/mol. IUPAC name: 1,3-dimethyl-4-nitropyrazole-5-carboxylic acid. InChIKey: MCTUAJONAXPWLC-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O4 |
|---|---|
| Molecular weight | 185.14 g/mol |
| IUPAC name | 1,3-dimethyl-4-nitropyrazole-5-carboxylic acid |
| InChIKey | MCTUAJONAXPWLC-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1[N+](=O)[O-])C(=O)O)C |
Computed by PubChem (NCBI)