CAS 41613-26-7 is the registry number for 1,3-Dimethyl-5-nitropyrimidine-2,4(1h,3h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,3-dimethyl-5-nitropyrimidine-2,4-dione (CAS 41613-26-7) is a chemical compound with the molecular formula C6H7N3O4 and a molecular weight of 185.14 g/mol. IUPAC name: 1,3-dimethyl-5-nitropyrimidine-2,4-dione. InChIKey: SDLBIQNBDPOOPJ-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O4 |
|---|---|
| Molecular weight | 185.14 g/mol |
| IUPAC name | 1,3-dimethyl-5-nitropyrimidine-2,4-dione |
| InChIKey | SDLBIQNBDPOOPJ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=O)N(C1=O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)