CAS 3920-37-4 appears in our catalog under these names: 1,3-Dimethyl-4-nitro-1h-pyrazole-5-carboxylic acid, 95%, 1,3-dimethyl-4-nitro-1H-pyrazole-5-carboxylic acid, 1,3-Dimethyl-4-nitro-1H-pyrazole-5-carboxylic acid 95%, 1,3-Dimethyl-4-nitro-1H-pyrazole-5-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
1,3-dimethyl-4-nitropyrazole-5-carboxylic acid (CAS 3920-37-4) is a chemical compound with the molecular formula C6H7N3O4 and a molecular weight of 185.14 g/mol. IUPAC name: 1,3-dimethyl-4-nitropyrazole-5-carboxylic acid. InChIKey: MCTUAJONAXPWLC-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O4 |
|---|---|
| Molecular weight | 185.14 g/mol |
| IUPAC name | 1,3-dimethyl-4-nitropyrazole-5-carboxylic acid |
| InChIKey | MCTUAJONAXPWLC-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1[N+](=O)[O-])C(=O)O)C |
Computed by PubChem (NCBI)