CAS 40361-79-3 appears in our catalog under these names: 3-Methyl-2-nitro-3h-imidazole-4-carboxylic acid methyl ester, 95%, Methyl 3-methyl-2-nitro-3H-imidazole-4-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Methyl 3-methyl-2-nitroimidazole-4-carboxylate (CAS 40361-79-3) is a chemical compound with the molecular formula C6H7N3O4 and a molecular weight of 185.14 g/mol. IUPAC name: methyl 3-methyl-2-nitroimidazole-4-carboxylate. InChIKey: BQTWOZOPNUFRHG-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O4 |
|---|---|
| Molecular weight | 185.14 g/mol |
| IUPAC name | methyl 3-methyl-2-nitroimidazole-4-carboxylate |
| InChIKey | BQTWOZOPNUFRHG-UHFFFAOYSA-N |
| SMILES | CN1C(=CN=C1[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)