CAS 865998-46-5 appears in our catalog under these names: Ethyl 5–nitro–1H–imidazole–2–carboxylate, Ethyl 5-nitro-1H-imidazole-2-carboxylate, 96%, Ethyl 5-nitro-1H-imidazole-2-carboxylate 97%, 1H-Imidazole-2-carboxylic acid, 5-nitro-, ethyl ester, 98%, 98%. Offered by: GLPBio, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 25g, 100mg.
Ethyl 5-nitro-1H-imidazole-2-carboxylate (CAS 865998-46-5) is a chemical compound with the molecular formula C6H7N3O4 and a molecular weight of 185.14 g/mol. IUPAC name: ethyl 5-nitro-1H-imidazole-2-carboxylate. InChIKey: YSVPLWXCZZORIO-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O4 |
|---|---|
| Molecular weight | 185.14 g/mol |
| IUPAC name | ethyl 5-nitro-1H-imidazole-2-carboxylate |
| InChIKey | YSVPLWXCZZORIO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC=C(N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)