cas: 52941-82-9 — see every product listed under this CAS number, including other names
1,3-Dioxan-5-one, 2-phenyl-, 98%, 98% (CAS 52941-82-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DLT0-100mg |
| cas | 52941-82-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 5g | 2642.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-phenyl-1,3-dioxan-5-one (CAS 52941-82-9) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 2-phenyl-1,3-dioxan-5-one. InChIKey: AFDCQVDEHZTFHC-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 2-phenyl-1,3-dioxan-5-one |
| InChIKey | AFDCQVDEHZTFHC-UHFFFAOYSA-N |
| SMILES | C1C(=O)COC(O1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)