cas: 52941-82-9 — see every product listed under this CAS number, including other names
2-Phenyl-1,3-dioxan-5-one, 98% (CAS 52941-82-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A262935-100mg |
| cas | 52941-82-9 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 213.22 Pln | |
| AmBeed | 10g | 8129.38 Pln | |
| Fluorochem | 100mg | 143.72 Pln | |
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 695.61 Pln | |
| Fluorochem | 5g | 3007.29 Pln | |
| Fluorochem | 10g | 5563.68 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-phenyl-1,3-dioxan-5-one (CAS 52941-82-9) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 2-phenyl-1,3-dioxan-5-one. InChIKey: AFDCQVDEHZTFHC-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 2-phenyl-1,3-dioxan-5-one |
| InChIKey | AFDCQVDEHZTFHC-UHFFFAOYSA-N |
| SMILES | C1C(=O)COC(O1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)