1,3-Dioxoisoindolin-2-yl isobutyrate, 97%
cas: 1631179-23-1 — see every product listed under this CAS number, including other names
1,3-Dioxoisoindolin-2-yl isobutyrate, 97% (CAS 1631179-23-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 100mg, 250mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1496194-1g |
| cas | 1631179-23-1 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 314.75 Pln | |
| Ambeed | 5g | 898.81 Pln | |
| Ambeed | 25g | 2962.50 Pln | |
| Ambeed | 100g | 9337.12 Pln | |
| BLDpharm | 1g | 331.02 Pln | |
| BLDpharm | 5g | 964.13 Pln | |
| BLDpharm | 25g | 3191.12 Pln | |
| BLDpharm | 100g | 10060.93 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 25g | 1864.40 Pln | |
| Fluorochem | 1g | 305.12 Pln | |
| Fluorochem | 5g | 804.94 Pln | |
| Fluorochem | 25g | 2944.81 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(1,3-dioxoisoindol-2-yl) 2-methylpropanoate (CAS 1631179-23-1) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 2-methylpropanoate. InChIKey: RHRVSKAAIXMYLC-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 2-methylpropanoate |
| InChIKey | RHRVSKAAIXMYLC-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)ON1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)