CAS 1631179-23-1 appears in our catalog under these names: 1,3-Dioxoisoindolin-2-yl isobutyrate, 97%, 97%, 1,3-Dioxoisoindolin-2-yl isobutyrate, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g.
(1,3-dioxoisoindol-2-yl) 2-methylpropanoate (CAS 1631179-23-1) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 2-methylpropanoate. InChIKey: RHRVSKAAIXMYLC-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 2-methylpropanoate |
| InChIKey | RHRVSKAAIXMYLC-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)ON1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)